C16H16BrNO3S — CID 133239527
5-bromo-1-(4-methoxyphenyl)sulfonyl-2-methyl-2,3-dihydroindole (PubChem CID 133239527) has the molecular formula C16H16BrNO3S and a molecular weight of 382.28 g/mol. Its IUPAC name is 5-bromo-1-(4-methoxyphenyl)sulfonyl-2-methyl-2,3-dihydroindole.
| Compound Name | 5-bromo-1-(4-methoxyphenyl)sulfonyl-2-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 133239527 |
| Molecular Formula | C16H16BrNO3S |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 5-bromo-1-(4-methoxyphenyl)sulfonyl-2-methyl-2,3-dihydroindole |
| SMILES | COc1ccc(S(=O)(=O)N2c3ccc(Br)cc3CC2C)cc1 |
| InChI | InChI=1S/C16H16BrNO3S/c1-11-9-12-10-13(17)3-8-16(12)18(11)22(19,20)15-6-4-14(21-2)5-7-15/h3-8,10-11H,9H2,1-2H3 |
| InChIKey | OKMNJNANPIWLAH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |