C17H17BrN2O6S2 — CID 24563307
methyl 5-bromo-2-[(2-methyl-5-sulfamoyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate (PubChem CID 24563307) has the molecular formula C17H17BrN2O6S2 and a molecular weight of 489.37 g/mol. Its IUPAC name is methyl 5-bromo-2-[(2-methyl-5-sulfamoyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate.
| Compound Name | methyl 5-bromo-2-[(2-methyl-5-sulfamoyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate |
|---|---|
| PubChem CID | 24563307 |
| Molecular Formula | C17H17BrN2O6S2 |
| Molecular Weight | 489.37 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | methyl 5-bromo-2-[(2-methyl-5-sulfamoyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate |
| SMILES | COC(=O)c1cc(Br)ccc1S(=O)(=O)N1c2ccc(S(N)(=O)=O)cc2CC1C |
| InChI | InChI=1S/C17H17BrN2O6S2/c1-10-7-11-8-13(27(19,22)23)4-5-15(11)20(10)28(24,25)16-6-3-12(18)9-14(16)17(21)26-2/h3-6,8-10H,7H2,1-2H3,(H2,19,22,23) |
| InChIKey | ZWJIHSCZXSRVIO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |