C12H18N2O3S — CID 111496549
1-(4-hydroxybutyl)-2,3-dihydroindole-6-sulfonamide (PubChem CID 111496549) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 1-(4-hydroxybutyl)-2,3-dihydroindole-6-sulfonamide.
| Compound Name | 1-(4-hydroxybutyl)-2,3-dihydroindole-6-sulfonamide |
|---|---|
| PubChem CID | 111496549 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-(4-hydroxybutyl)-2,3-dihydroindole-6-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)N(CCCCO)CC2 |
| InChI | InChI=1S/C12H18N2O3S/c13-18(16,17)11-4-3-10-5-7-14(12(10)9-11)6-1-2-8-15/h3-4,9,15H,1-2,5-8H2,(H2,13,16,17) |
| InChIKey | MCKBOVUPKYMJEZ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|