C14H16N2O3S — CID 154748876
1-hexa-2,4-dienoyl-2,3-dihydroindole-6-sulfonamide (PubChem CID 154748876) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 1-hexa-2,4-dienoyl-2,3-dihydroindole-6-sulfonamide.
| Compound Name | 1-hexa-2,4-dienoyl-2,3-dihydroindole-6-sulfonamide |
|---|---|
| PubChem CID | 154748876 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-hexa-2,4-dienoyl-2,3-dihydroindole-6-sulfonamide |
| SMILES | CC=CC=CC(=O)N1CCc2ccc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C14H16N2O3S/c1-2-3-4-5-14(17)16-9-8-11-6-7-12(10-13(11)16)20(15,18)19/h2-7,10H,8-9H2,1H3,(H2,15,18,19) |
| InChIKey | MNDXFICDFORWAF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|