C15H18N2O — CID 113341665
1-(5-amino-3,4-dihydro-2H-quinolin-1-yl)hexa-2,4-dien-1-one (PubChem CID 113341665) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-(5-amino-3,4-dihydro-2H-quinolin-1-yl)hexa-2,4-dien-1-one.
| Compound Name | 1-(5-amino-3,4-dihydro-2H-quinolin-1-yl)hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 113341665 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 1-(5-amino-3,4-dihydro-2H-quinolin-1-yl)hexa-2,4-dien-1-one |
| SMILES | CC=CC=CC(=O)N1CCCc2c(N)cccc21 |
| InChI | InChI=1S/C15H18N2O/c1-2-3-4-10-15(18)17-11-6-7-12-13(16)8-5-9-14(12)17/h2-5,8-10H,6-7,11,16H2,1H3 |
| InChIKey | LLZZVNRNROBUOW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|