C15H22N2O — CID 82705400
1-(5-amino-3,4-dihydro-2H-quinolin-1-yl)-2-methylpentan-1-one (PubChem CID 82705400) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-(5-amino-3,4-dihydro-2H-quinolin-1-yl)-2-methylpentan-1-one.
| Compound Name | 1-(5-amino-3,4-dihydro-2H-quinolin-1-yl)-2-methylpentan-1-one |
|---|---|
| PubChem CID | 82705400 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 1-(5-amino-3,4-dihydro-2H-quinolin-1-yl)-2-methylpentan-1-one |
| SMILES | CCCC(C)C(=O)N1CCCc2c(N)cccc21 |
| InChI | InChI=1S/C15H22N2O/c1-3-6-11(2)15(18)17-10-5-7-12-13(16)8-4-9-14(12)17/h4,8-9,11H,3,5-7,10,16H2,1-2H3 |
| InChIKey | GCVSCAPQYAUGTM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|