C15H19N5O — CID 82744475
(5-amino-3,4-dihydro-2H-quinolin-1-yl)-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)methanone (PubChem CID 82744475) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)methanone.
| Compound Name | (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)methanone |
|---|---|
| PubChem CID | 82744475 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)methanone |
| SMILES | CC(C)c1nc(C(=O)N2CCCc3c(N)cccc32)n[nH]1 |
| InChI | InChI=1S/C15H19N5O/c1-9(2)13-17-14(19-18-13)15(21)20-8-4-5-10-11(16)6-3-7-12(10)20/h3,6-7,9H,4-5,8,16H2,1-2H3,(H,17,18,19) |
| InChIKey | VCDZABCQLZVZJC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|