C14H16N4O — CID 82706431
(5-amino-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1H-pyrazol-4-yl)methanone (PubChem CID 82706431) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1H-pyrazol-4-yl)methanone.
| Compound Name | (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 82706431 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1H-pyrazol-4-yl)methanone |
| SMILES | Cc1[nH]ncc1C(=O)N1CCCc2c(N)cccc21 |
| InChI | InChI=1S/C14H16N4O/c1-9-11(8-16-17-9)14(19)18-7-3-4-10-12(15)5-2-6-13(10)18/h2,5-6,8H,3-4,7,15H2,1H3,(H,16,17) |
| InChIKey | CYZPEIIGPCUWMK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|