C10H12N2O — CID 13236630
1-(4-amino-2,3-dihydroindol-1-yl)ethanone (PubChem CID 13236630) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-(4-amino-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 1-(4-amino-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 13236630 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 1-(4-amino-2,3-dihydroindol-1-yl)ethanone |
| SMILES | CC(=O)N1CCc2c(N)cccc21 |
| InChI | InChI=1S/C10H12N2O/c1-7(13)12-6-5-8-9(11)3-2-4-10(8)12/h2-4H,5-6,11H2,1H3 |
| InChIKey | NADMMXZGSDHVNN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|