C10H11NO2 — CID 19598465
1-(4-hydroxy-2,3-dihydroindol-1-yl)ethanone (PubChem CID 19598465) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 1-(4-hydroxy-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 1-(4-hydroxy-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 19598465 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 1-(4-hydroxy-2,3-dihydroindol-1-yl)ethanone |
| SMILES | CC(=O)N1CCc2c(O)cccc21 |
| InChI | InChI=1S/C10H11NO2/c1-7(12)11-6-5-8-9(11)3-2-4-10(8)13/h2-4,13H,5-6H2,1H3 |
| InChIKey | MOCNHZXRXZCZKR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |