C11H10N2O — CID 82655574
1-acetyl-2,3-dihydroindole-4-carbonitrile (PubChem CID 82655574) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-acetyl-2,3-dihydroindole-4-carbonitrile.
| Compound Name | 1-acetyl-2,3-dihydroindole-4-carbonitrile |
|---|---|
| PubChem CID | 82655574 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 1-acetyl-2,3-dihydroindole-4-carbonitrile |
| SMILES | CC(=O)N1CCc2c(C#N)cccc21 |
| InChI | InChI=1S/C11H10N2O/c1-8(14)13-6-5-10-9(7-12)3-2-4-11(10)13/h2-4H,5-6H2,1H3 |
| InChIKey | QAWGVXNSVQEZJY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |