C12H11ClN2O — CID 166409152
1-(2-chloroacetyl)-3,4-dihydro-2H-quinoline-5-carbonitrile (PubChem CID 166409152) has the molecular formula C12H11ClN2O and a molecular weight of 234.69 g/mol. Its IUPAC name is 1-(2-chloroacetyl)-3,4-dihydro-2H-quinoline-5-carbonitrile.
| Compound Name | 1-(2-chloroacetyl)-3,4-dihydro-2H-quinoline-5-carbonitrile |
|---|---|
| PubChem CID | 166409152 |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 1-(2-chloroacetyl)-3,4-dihydro-2H-quinoline-5-carbonitrile |
| SMILES | N#Cc1cccc2c1CCCN2C(=O)CCl |
| InChI | InChI=1S/C12H11ClN2O/c13-7-12(16)15-6-2-4-10-9(8-14)3-1-5-11(10)15/h1,3,5H,2,4,6-7H2 |
| InChIKey | PFTPCEXCMVZSDF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|