C12H12BrNO3 — CID 156507049
3-(5-bromo-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropanoic acid (PubChem CID 156507049) has the molecular formula C12H12BrNO3 and a molecular weight of 298.14 g/mol. Its IUPAC name is 3-(5-bromo-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropanoic acid.
| Compound Name | 3-(5-bromo-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 156507049 |
| Molecular Formula | C12H12BrNO3 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 3-(5-bromo-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)N1CCCc2c(Br)cccc21 |
| InChI | InChI=1S/C12H12BrNO3/c13-9-4-1-5-10-8(9)3-2-6-14(10)11(15)7-12(16)17/h1,4-5H,2-3,6-7H2,(H,16,17) |
| InChIKey | OHUCJFMXXUVEHT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|