C16H18BrNO — CID 75454585
(6-bromo-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-cyclopent-3-en-1-ylmethanone (PubChem CID 75454585) has the molecular formula C16H18BrNO and a molecular weight of 320.23 g/mol. Its IUPAC name is (6-bromo-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-cyclopent-3-en-1-ylmethanone.
| Compound Name | (6-bromo-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-cyclopent-3-en-1-ylmethanone |
|---|---|
| PubChem CID | 75454585 |
| Molecular Formula | C16H18BrNO |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | (6-bromo-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-cyclopent-3-en-1-ylmethanone |
| SMILES | O=C(C1CC=CC1)N1CCCCc2c(Br)cccc21 |
| InChI | InChI=1S/C16H18BrNO/c17-14-9-5-10-15-13(14)8-3-4-11-18(15)16(19)12-6-1-2-7-12/h1-2,5,9-10,12H,3-4,6-8,11H2 |
| InChIKey | BGXMCWMOYXTLTK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|