C9H9N3 — CID 175227069
1-amino-2,3-dihydroindole-4-carbonitrile (PubChem CID 175227069) has the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. Its IUPAC name is 1-amino-2,3-dihydroindole-4-carbonitrile.
| Compound Name | 1-amino-2,3-dihydroindole-4-carbonitrile |
|---|---|
| PubChem CID | 175227069 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 1-amino-2,3-dihydroindole-4-carbonitrile |
| SMILES | N#Cc1cccc2c1CCN2N |
| InChI | InChI=1S/C9H9N3/c10-6-7-2-1-3-9-8(7)4-5-12(9)11/h1-3H,4-5,11H2 |
| InChIKey | SZZJEXAXYOGJAA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|