C10H9BrFNO — CID 82380433
1-(5-bromo-4-fluoro-2,3-dihydroindol-1-yl)ethanone (PubChem CID 82380433) has the molecular formula C10H9BrFNO and a molecular weight of 258.09 g/mol. Its IUPAC name is 1-(5-bromo-4-fluoro-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 1-(5-bromo-4-fluoro-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 82380433 |
| Molecular Formula | C10H9BrFNO |
| Molecular Weight | 258.09 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 1-(5-bromo-4-fluoro-2,3-dihydroindol-1-yl)ethanone |
| SMILES | CC(=O)N1CCc2c1ccc(Br)c2F |
| InChI | InChI=1S/C10H9BrFNO/c1-6(14)13-5-4-7-9(13)3-2-8(11)10(7)12/h2-3H,4-5H2,1H3 |
| InChIKey | CTBFANKUYPZXKX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.09 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |