C10H9BrClNOS — CID 145018684
(1-acetyl-5-bromo-2,3-dihydroindol-6-yl) thiohypochlorite (PubChem CID 145018684) has the molecular formula C10H9BrClNOS and a molecular weight of 306.61 g/mol. Its IUPAC name is (1-acetyl-5-bromo-2,3-dihydroindol-6-yl) thiohypochlorite.
| Compound Name | (1-acetyl-5-bromo-2,3-dihydroindol-6-yl) thiohypochlorite |
|---|---|
| PubChem CID | 145018684 |
| Molecular Formula | C10H9BrClNOS |
| Molecular Weight | 306.61 g/mol |
| Exact Mass | 304.93 |
| IUPAC Name | (1-acetyl-5-bromo-2,3-dihydroindol-6-yl) thiohypochlorite |
| SMILES | CC(=O)N1CCc2cc(Br)c(SCl)cc21 |
| InChI | InChI=1S/C10H9BrClNOS/c1-6(14)13-3-2-7-4-8(11)10(15-12)5-9(7)13/h4-5H,2-3H2,1H3 |
| InChIKey | MJDFTEJVSJIMHA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |