C16H15N3O2S2 — CID 56792914
1-(1,3-benzothiazol-2-ylmethyl)-2,3-dihydroindole-6-sulfonamide (PubChem CID 56792914) has the molecular formula C16H15N3O2S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)-2,3-dihydroindole-6-sulfonamide.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)-2,3-dihydroindole-6-sulfonamide |
|---|---|
| PubChem CID | 56792914 |
| Molecular Formula | C16H15N3O2S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)-2,3-dihydroindole-6-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)N(Cc1nc3ccccc3s1)CC2 |
| InChI | InChI=1S/C16H15N3O2S2/c17-23(20,21)12-6-5-11-7-8-19(14(11)9-12)10-16-18-13-3-1-2-4-15(13)22-16/h1-6,9H,7-8,10H2,(H2,17,20,21) |
| InChIKey | GQBPJDLXFNUOMX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |