C15H13F3N2O5S2 — CID 31781525
1-[3-(trifluoromethoxy)phenyl]sulfonyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 31781525) has the molecular formula C15H13F3N2O5S2 and a molecular weight of 422.41 g/mol. Its IUPAC name is 1-[3-(trifluoromethoxy)phenyl]sulfonyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[3-(trifluoromethoxy)phenyl]sulfonyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 31781525 |
| Molecular Formula | C15H13F3N2O5S2 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 1-[3-(trifluoromethoxy)phenyl]sulfonyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2S(=O)(=O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C15H13F3N2O5S2/c16-15(17,18)25-11-2-1-3-13(9-11)27(23,24)20-7-6-10-8-12(26(19,21)22)4-5-14(10)20/h1-5,8-9H,6-7H2,(H2,19,21,22) |
| InChIKey | PPSKMBHIPNMEHV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |