C12H18N2O4S2 — CID 62998922
1-(2-methylpropylsulfonyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 62998922) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-(2-methylpropylsulfonyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(2-methylpropylsulfonyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 62998922 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 1-(2-methylpropylsulfonyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(C)CS(=O)(=O)N1CCc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C12H18N2O4S2/c1-9(2)8-19(15,16)14-6-5-10-7-11(20(13,17)18)3-4-12(10)14/h3-4,7,9H,5-6,8H2,1-2H3,(H2,13,17,18) |
| InChIKey | LDDWAIAMXGBMPN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |