C16H13N3O6S2 — CID 56561787
1-(1,3-dioxoisoindol-5-yl)sulfonyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 56561787) has the molecular formula C16H13N3O6S2 and a molecular weight of 407.43 g/mol. Its IUPAC name is 1-(1,3-dioxoisoindol-5-yl)sulfonyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(1,3-dioxoisoindol-5-yl)sulfonyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 56561787 |
| Molecular Formula | C16H13N3O6S2 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 1-(1,3-dioxoisoindol-5-yl)sulfonyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2S(=O)(=O)c1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C16H13N3O6S2/c17-26(22,23)10-2-4-14-9(7-10)5-6-19(14)27(24,25)11-1-3-12-13(8-11)16(21)18-15(12)20/h1-4,7-8H,5-6H2,(H2,17,22,23)(H,18,20,21) |
| InChIKey | SKDATNALOYOGPS-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|