C21H16N4O5S — CID 169329693
4-amino-5-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169329693) has the molecular formula C21H16N4O5S and a molecular weight of 436.45 g/mol. Its IUPAC name is 4-amino-5-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169329693 |
| Molecular Formula | C21H16N4O5S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 4-amino-5-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1ccc(S(=O)(=O)N3CCc4ccccc43)cc1)C(=O)NC2=O |
| InChI | InChI=1S/C21H16N4O5S/c22-19-18-15(20(27)23-21(18)28)11-17(26)25(19)13-5-7-14(8-6-13)31(29,30)24-10-9-12-3-1-2-4-16(12)24/h1-8,11H,9-10,22H2,(H,23,27,28) |
| InChIKey | SBYFNAJLOFFSPR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|