C22H17N3O4S — CID 22432827
3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-2H-phthalazine-1,4-dione (PubChem CID 22432827) has the molecular formula C22H17N3O4S and a molecular weight of 419.46 g/mol. Its IUPAC name is 3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-2H-phthalazine-1,4-dione.
| Compound Name | 3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-2H-phthalazine-1,4-dione |
|---|---|
| PubChem CID | 22432827 |
| Molecular Formula | C22H17N3O4S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-2H-phthalazine-1,4-dione |
| SMILES | O=c1[nH]n(-c2ccc(S(=O)(=O)N3CCc4ccccc43)cc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H17N3O4S/c26-21-18-6-2-3-7-19(18)22(27)25(23-21)16-9-11-17(12-10-16)30(28,29)24-14-13-15-5-1-4-8-20(15)24/h1-12H,13-14H2,(H,23,26) |
| InChIKey | TYQCLEXLJHFOEG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |