C21H18N2O2S — CID 4512362
N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-1-phenylmethanimine (PubChem CID 4512362) has the molecular formula C21H18N2O2S and a molecular weight of 362.45 g/mol. Its IUPAC name is N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-1-phenylmethanimine.
| Compound Name | N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 4512362 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-1-phenylmethanimine |
| SMILES | O=S(=O)(c1ccc(/N=C/c2ccccc2)cc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H18N2O2S/c24-26(25,23-15-14-18-8-4-5-9-21(18)23)20-12-10-19(11-13-20)22-16-17-6-2-1-3-7-17/h1-13,16H,14-15H2/b22-16+ |
| InChIKey | CHSCPKFLTBDKGC-CJLVFECKSA-N |
| XLogP | 4.19 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|