C15H16N2O4S2 — CID 31064364
3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide (PubChem CID 31064364) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide.
| Compound Name | 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 31064364 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C15H16N2O4S2/c16-22(18,19)13-7-3-8-14(11-13)23(20,21)17-10-4-6-12-5-1-2-9-15(12)17/h1-3,5,7-9,11H,4,6,10H2,(H2,16,18,19) |
| InChIKey | RPMCQXIEQZEQAH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |