C18H22N2O4S2 — CID 47784402
N-methyl-1-(4-propylphenyl)sulfonyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 47784402) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-methyl-1-(4-propylphenyl)sulfonyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N-methyl-1-(4-propylphenyl)sulfonyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 47784402 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N-methyl-1-(4-propylphenyl)sulfonyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)N2CCc3cc(S(=O)(=O)NC)ccc32)cc1 |
| InChI | InChI=1S/C18H22N2O4S2/c1-3-4-14-5-7-16(8-6-14)26(23,24)20-12-11-15-13-17(9-10-18(15)20)25(21,22)19-2/h5-10,13,19H,3-4,11-12H2,1-2H3 |
| InChIKey | GTIJYXZENBCGEQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |