C15H14BrClN2O4S2 — CID 60586163
1-(4-bromo-2-chlorophenyl)sulfonyl-N-methyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 60586163) has the molecular formula C15H14BrClN2O4S2 and a molecular weight of 465.78 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)sulfonyl-N-methyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(4-bromo-2-chlorophenyl)sulfonyl-N-methyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 60586163 |
| Molecular Formula | C15H14BrClN2O4S2 |
| Molecular Weight | 465.78 g/mol |
| Exact Mass | 463.93 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)sulfonyl-N-methyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)CCN2S(=O)(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H14BrClN2O4S2/c1-18-24(20,21)12-3-4-14-10(8-12)6-7-19(14)25(22,23)15-5-2-11(16)9-13(15)17/h2-5,8-9,18H,6-7H2,1H3 |
| InChIKey | IWNMQVKOLKWKDV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.78 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |