C19H21ClN2O4S2 — CID 19164457
1-(4-chlorophenyl)sulfonyl-N-cyclopentyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 19164457) has the molecular formula C19H21ClN2O4S2 and a molecular weight of 440.97 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-cyclopentyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-cyclopentyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 19164457 |
| Molecular Formula | C19H21ClN2O4S2 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-cyclopentyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | O=S(=O)(NC1CCCC1)c1ccc2c(c1)CCN2S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN2O4S2/c20-15-5-7-17(8-6-15)28(25,26)22-12-11-14-13-18(9-10-19(14)22)27(23,24)21-16-3-1-2-4-16/h5-10,13,16,21H,1-4,11-12H2 |
| InChIKey | OACXLFJRELWBLU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |