C18H17ClN2O3S — CID 23608854
1-(4-chlorophenyl)sulfonyl-N-cyclopropyl-2,3-dihydroindole-5-carboxamide (PubChem CID 23608854) has the molecular formula C18H17ClN2O3S and a molecular weight of 376.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-cyclopropyl-2,3-dihydroindole-5-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-cyclopropyl-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 23608854 |
| Molecular Formula | C18H17ClN2O3S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-cyclopropyl-2,3-dihydroindole-5-carboxamide |
| SMILES | O=C(NC1CC1)c1ccc2c(c1)CCN2S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClN2O3S/c19-14-2-6-16(7-3-14)25(23,24)21-10-9-12-11-13(1-8-17(12)21)18(22)20-15-4-5-15/h1-3,6-8,11,15H,4-5,9-10H2,(H,20,22) |
| InChIKey | RTDUIPJUMHDKRK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |