C18H20ClN3O2S — CID 148988411
1-(4-chlorophenyl)sulfonyl-5-piperazin-1-yl-2,3-dihydroindole (PubChem CID 148988411) has the molecular formula C18H20ClN3O2S and a molecular weight of 377.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-5-piperazin-1-yl-2,3-dihydroindole.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-5-piperazin-1-yl-2,3-dihydroindole |
|---|---|
| PubChem CID | 148988411 |
| Molecular Formula | C18H20ClN3O2S |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-5-piperazin-1-yl-2,3-dihydroindole |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCc2cc(N3CCNCC3)ccc21 |
| InChI | InChI=1S/C18H20ClN3O2S/c19-15-1-4-17(5-2-15)25(23,24)22-10-7-14-13-16(3-6-18(14)22)21-11-8-20-9-12-21/h1-6,13,20H,7-12H2 |
| InChIKey | PXFIIFISAGEPIK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|