C20H19BrCl3N3O3S — CID 151564793
1-[4-[1-(4-bromophenyl)sulfonyl-2,3-dihydroindol-5-yl]piperazin-1-yl]-2,2,2-trichloroethanone (PubChem CID 151564793) has the molecular formula C20H19BrCl3N3O3S and a molecular weight of 567.72 g/mol. Its IUPAC name is 1-[4-[1-(4-bromophenyl)sulfonyl-2,3-dihydroindol-5-yl]piperazin-1-yl]-2,2,2-trichloroethanone.
| Compound Name | 1-[4-[1-(4-bromophenyl)sulfonyl-2,3-dihydroindol-5-yl]piperazin-1-yl]-2,2,2-trichloroethanone |
|---|---|
| PubChem CID | 151564793 |
| Molecular Formula | C20H19BrCl3N3O3S |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 564.94 |
| IUPAC Name | 1-[4-[1-(4-bromophenyl)sulfonyl-2,3-dihydroindol-5-yl]piperazin-1-yl]-2,2,2-trichloroethanone |
| SMILES | O=C(N1CCN(c2ccc3c(c2)CCN3S(=O)(=O)c2ccc(Br)cc2)CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H19BrCl3N3O3S/c21-15-1-4-17(5-2-15)31(29,30)27-8-7-14-13-16(3-6-18(14)27)25-9-11-26(12-10-25)19(28)20(22,23)24/h1-6,13H,7-12H2 |
| InChIKey | QDEZSURVHSFECY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|