C20H24N2O3S — CID 110316058
1-(4-ethoxyphenyl)sulfonyl-5-pyrrolidin-1-yl-2,3-dihydroindole (PubChem CID 110316058) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)sulfonyl-5-pyrrolidin-1-yl-2,3-dihydroindole.
| Compound Name | 1-(4-ethoxyphenyl)sulfonyl-5-pyrrolidin-1-yl-2,3-dihydroindole |
|---|---|
| PubChem CID | 110316058 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-(4-ethoxyphenyl)sulfonyl-5-pyrrolidin-1-yl-2,3-dihydroindole |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCc3cc(N4CCCC4)ccc32)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c1-2-25-18-6-8-19(9-7-18)26(23,24)22-14-11-16-15-17(5-10-20(16)22)21-12-3-4-13-21/h5-10,15H,2-4,11-14H2,1H3 |
| InChIKey | NNRHGSDRBLDTEA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|