C15H20N2O2 — CID 110316008
ethyl 5-pyrrolidin-1-yl-2,3-dihydroindole-1-carboxylate (PubChem CID 110316008) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is ethyl 5-pyrrolidin-1-yl-2,3-dihydroindole-1-carboxylate.
| Compound Name | ethyl 5-pyrrolidin-1-yl-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 110316008 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | ethyl 5-pyrrolidin-1-yl-2,3-dihydroindole-1-carboxylate |
| SMILES | CCOC(=O)N1CCc2cc(N3CCCC3)ccc21 |
| InChI | InChI=1S/C15H20N2O2/c1-2-19-15(18)17-10-7-12-11-13(5-6-14(12)17)16-8-3-4-9-16/h5-6,11H,2-4,7-10H2,1H3 |
| InChIKey | XNQMXTCPBJKPSL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|