C20H23N3O3S — CID 110316012
N-(4-methylphenyl)sulfonyl-5-pyrrolidin-1-yl-2,3-dihydroindole-1-carboxamide (PubChem CID 110316012) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfonyl-5-pyrrolidin-1-yl-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-(4-methylphenyl)sulfonyl-5-pyrrolidin-1-yl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 110316012 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-(4-methylphenyl)sulfonyl-5-pyrrolidin-1-yl-2,3-dihydroindole-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)N2CCc3cc(N4CCCC4)ccc32)cc1 |
| InChI | InChI=1S/C20H23N3O3S/c1-15-4-7-18(8-5-15)27(25,26)21-20(24)23-13-10-16-14-17(6-9-19(16)23)22-11-2-3-12-22/h4-9,14H,2-3,10-13H2,1H3,(H,21,24) |
| InChIKey | PPFKNPDRICLQEX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|