C18H17N3O3S2 — CID 2308137
[1-[(4-methylphenyl)sulfonylcarbamoyl]-3,4-dihydro-2H-quinolin-6-yl] thiocyanate (PubChem CID 2308137) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is [1-[(4-methylphenyl)sulfonylcarbamoyl]-3,4-dihydro-2H-quinolin-6-yl] thiocyanate.
| Compound Name | [1-[(4-methylphenyl)sulfonylcarbamoyl]-3,4-dihydro-2H-quinolin-6-yl] thiocyanate |
|---|---|
| PubChem CID | 2308137 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | [1-[(4-methylphenyl)sulfonylcarbamoyl]-3,4-dihydro-2H-quinolin-6-yl] thiocyanate |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)N2CCCc3cc(SC#N)ccc32)cc1 |
| InChI | InChI=1S/C18H17N3O3S2/c1-13-4-7-16(8-5-13)26(23,24)20-18(22)21-10-2-3-14-11-15(25-12-19)6-9-17(14)21/h4-9,11H,2-3,10H2,1H3,(H,20,22) |
| InChIKey | HOCIUQIACBBSKS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|