C19H18F2N2O — CID 110316006
(3,4-difluorophenyl)-(5-pyrrolidin-1-yl-2,3-dihydroindol-1-yl)methanone (PubChem CID 110316006) has the molecular formula C19H18F2N2O and a molecular weight of 328.36 g/mol. Its IUPAC name is (3,4-difluorophenyl)-(5-pyrrolidin-1-yl-2,3-dihydroindol-1-yl)methanone.
| Compound Name | (3,4-difluorophenyl)-(5-pyrrolidin-1-yl-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 110316006 |
| Molecular Formula | C19H18F2N2O |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (3,4-difluorophenyl)-(5-pyrrolidin-1-yl-2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1)N1CCc2cc(N3CCCC3)ccc21 |
| InChI | InChI=1S/C19H18F2N2O/c20-16-5-3-14(12-17(16)21)19(24)23-10-7-13-11-15(4-6-18(13)23)22-8-1-2-9-22/h3-6,11-12H,1-2,7-10H2 |
| InChIKey | SLHGJFJKGZDHKN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|