C15H12ClFN2O — CID 82875817
(5-amino-2,3-dihydroindol-1-yl)-(3-chloro-4-fluorophenyl)methanone (PubChem CID 82875817) has the molecular formula C15H12ClFN2O and a molecular weight of 290.73 g/mol. Its IUPAC name is (5-amino-2,3-dihydroindol-1-yl)-(3-chloro-4-fluorophenyl)methanone.
| Compound Name | (5-amino-2,3-dihydroindol-1-yl)-(3-chloro-4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 82875817 |
| Molecular Formula | C15H12ClFN2O |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | (5-amino-2,3-dihydroindol-1-yl)-(3-chloro-4-fluorophenyl)methanone |
| SMILES | Nc1ccc2c(c1)CCN2C(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H12ClFN2O/c16-12-8-10(1-3-13(12)17)15(20)19-6-5-9-7-11(18)2-4-14(9)19/h1-4,7-8H,5-6,18H2 |
| InChIKey | FTEPHTKCCYNPAQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|