C15H10BrCl2NO — CID 47444577
(5-bromo-2,3-dihydroindol-1-yl)-(3,4-dichlorophenyl)methanone (PubChem CID 47444577) has the molecular formula C15H10BrCl2NO and a molecular weight of 371.06 g/mol. Its IUPAC name is (5-bromo-2,3-dihydroindol-1-yl)-(3,4-dichlorophenyl)methanone.
| Compound Name | (5-bromo-2,3-dihydroindol-1-yl)-(3,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 47444577 |
| Molecular Formula | C15H10BrCl2NO |
| Molecular Weight | 371.06 g/mol |
| Exact Mass | 368.93 |
| IUPAC Name | (5-bromo-2,3-dihydroindol-1-yl)-(3,4-dichlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)N1CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C15H10BrCl2NO/c16-11-2-4-14-9(7-11)5-6-19(14)15(20)10-1-3-12(17)13(18)8-10/h1-4,7-8H,5-6H2 |
| InChIKey | JBHWGROZAIILTG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.06 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |