C19H20Cl2N2O3S — CID 26765696
1-(3,4-dichlorobenzoyl)-N,N-diethyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 26765696) has the molecular formula C19H20Cl2N2O3S and a molecular weight of 427.35 g/mol. Its IUPAC name is 1-(3,4-dichlorobenzoyl)-N,N-diethyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(3,4-dichlorobenzoyl)-N,N-diethyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 26765696 |
| Molecular Formula | C19H20Cl2N2O3S |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 1-(3,4-dichlorobenzoyl)-N,N-diethyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)CCN2C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H20Cl2N2O3S/c1-3-22(4-2)27(25,26)15-6-8-18-13(11-15)9-10-23(18)19(24)14-5-7-16(20)17(21)12-14/h5-8,11-12H,3-4,9-10H2,1-2H3 |
| InChIKey | NVDMMVPGPQSLFT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |