C22H28N2O6S — CID 4045730
N,N-diethyl-1-(3,4,5-trimethoxybenzoyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 4045730) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is N,N-diethyl-1-(3,4,5-trimethoxybenzoyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N,N-diethyl-1-(3,4,5-trimethoxybenzoyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 4045730 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | N,N-diethyl-1-(3,4,5-trimethoxybenzoyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)CCN2C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H28N2O6S/c1-6-23(7-2)31(26,27)17-8-9-18-15(12-17)10-11-24(18)22(25)16-13-19(28-3)21(30-5)20(14-16)29-4/h8-9,12-14H,6-7,10-11H2,1-5H3 |
| InChIKey | CLUUHMATIQLGJX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |