C23H31N3O3S — CID 112800385
1-[4-(diethylamino)benzoyl]-N,N-diethyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 112800385) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is 1-[4-(diethylamino)benzoyl]-N,N-diethyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[4-(diethylamino)benzoyl]-N,N-diethyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 112800385 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 1-[4-(diethylamino)benzoyl]-N,N-diethyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CCN(CC)c1ccc(C(=O)N2CCc3cc(S(=O)(=O)N(CC)CC)ccc32)cc1 |
| InChI | InChI=1S/C23H31N3O3S/c1-5-24(6-2)20-11-9-18(10-12-20)23(27)26-16-15-19-17-21(13-14-22(19)26)30(28,29)25(7-3)8-4/h9-14,17H,5-8,15-16H2,1-4H3 |
| InChIKey | PIZIORZEVSTEPL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |