C18H14F2N4O — CID 142623956
(5-amino-2,3-dihydroindol-1-yl)-[1-(2,4-difluorophenyl)pyrazol-4-yl]methanone (PubChem CID 142623956) has the molecular formula C18H14F2N4O and a molecular weight of 340.33 g/mol. Its IUPAC name is (5-amino-2,3-dihydroindol-1-yl)-[1-(2,4-difluorophenyl)pyrazol-4-yl]methanone.
| Compound Name | (5-amino-2,3-dihydroindol-1-yl)-[1-(2,4-difluorophenyl)pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 142623956 |
| Molecular Formula | C18H14F2N4O |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (5-amino-2,3-dihydroindol-1-yl)-[1-(2,4-difluorophenyl)pyrazol-4-yl]methanone |
| SMILES | Nc1ccc2c(c1)CCN2C(=O)c1cnn(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C18H14F2N4O/c19-13-1-3-17(15(20)8-13)24-10-12(9-22-24)18(25)23-6-5-11-7-14(21)2-4-16(11)23/h1-4,7-10H,5-6,21H2 |
| InChIKey | SKFHEIHGTKCUHD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|