C16H14F2N2O — CID 103493768
(3-amino-5-fluoro-4-methylphenyl)-(6-fluoro-2,3-dihydroindol-1-yl)methanone (PubChem CID 103493768) has the molecular formula C16H14F2N2O and a molecular weight of 288.30 g/mol. Its IUPAC name is (3-amino-5-fluoro-4-methylphenyl)-(6-fluoro-2,3-dihydroindol-1-yl)methanone.
| Compound Name | (3-amino-5-fluoro-4-methylphenyl)-(6-fluoro-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 103493768 |
| Molecular Formula | C16H14F2N2O |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (3-amino-5-fluoro-4-methylphenyl)-(6-fluoro-2,3-dihydroindol-1-yl)methanone |
| SMILES | Cc1c(N)cc(C(=O)N2CCc3ccc(F)cc32)cc1F |
| InChI | InChI=1S/C16H14F2N2O/c1-9-13(18)6-11(7-14(9)19)16(21)20-5-4-10-2-3-12(17)8-15(10)20/h2-3,6-8H,4-5,19H2,1H3 |
| InChIKey | BMNFMXDWMCWCMJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|