C14H10BrFN2O — CID 103718991
(6-bromo-3-pyridinyl)-(6-fluoro-2,3-dihydroindol-1-yl)methanone (PubChem CID 103718991) has the molecular formula C14H10BrFN2O and a molecular weight of 321.15 g/mol. Its IUPAC name is (6-bromo-3-pyridinyl)-(6-fluoro-2,3-dihydroindol-1-yl)methanone.
| Compound Name | (6-bromo-3-pyridinyl)-(6-fluoro-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 103718991 |
| Molecular Formula | C14H10BrFN2O |
| Molecular Weight | 321.15 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | (6-bromo-3-pyridinyl)-(6-fluoro-2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1ccc(Br)nc1)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C14H10BrFN2O/c15-13-4-2-10(8-17-13)14(19)18-6-5-9-1-3-11(16)7-12(9)18/h1-4,7-8H,5-6H2 |
| InChIKey | XGHUMBRNOSEIAC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.15 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|