C15H14FN3O — CID 103493819
(2,4-diaminophenyl)-(6-fluoro-2,3-dihydroindol-1-yl)methanone (PubChem CID 103493819) has the molecular formula C15H14FN3O and a molecular weight of 271.30 g/mol. Its IUPAC name is (2,4-diaminophenyl)-(6-fluoro-2,3-dihydroindol-1-yl)methanone.
| Compound Name | (2,4-diaminophenyl)-(6-fluoro-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 103493819 |
| Molecular Formula | C15H14FN3O |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (2,4-diaminophenyl)-(6-fluoro-2,3-dihydroindol-1-yl)methanone |
| SMILES | Nc1ccc(C(=O)N2CCc3ccc(F)cc32)c(N)c1 |
| InChI | InChI=1S/C15H14FN3O/c16-10-2-1-9-5-6-19(14(9)7-10)15(20)12-4-3-11(17)8-13(12)18/h1-4,7-8H,5-6,17-18H2 |
| InChIKey | YNQJYOGCWJTFDY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|