C15H11ClFNOS — CID 107037112
(2-chloro-5-sulfanylphenyl)-(6-fluoro-2,3-dihydroindol-1-yl)methanone (PubChem CID 107037112) has the molecular formula C15H11ClFNOS and a molecular weight of 307.78 g/mol. Its IUPAC name is (2-chloro-5-sulfanylphenyl)-(6-fluoro-2,3-dihydroindol-1-yl)methanone.
| Compound Name | (2-chloro-5-sulfanylphenyl)-(6-fluoro-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 107037112 |
| Molecular Formula | C15H11ClFNOS |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | (2-chloro-5-sulfanylphenyl)-(6-fluoro-2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1cc(S)ccc1Cl)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C15H11ClFNOS/c16-13-4-3-11(20)8-12(13)15(19)18-6-5-9-1-2-10(17)7-14(9)18/h1-4,7-8,20H,5-6H2 |
| InChIKey | CXDMDHPZHPZXIK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|