C17H13FN2O — CID 103720917
(6-fluoro-2,3-dihydroindol-1-yl)-(1H-indol-4-yl)methanone (PubChem CID 103720917) has the molecular formula C17H13FN2O and a molecular weight of 280.30 g/mol. Its IUPAC name is (6-fluoro-2,3-dihydroindol-1-yl)-(1H-indol-4-yl)methanone.
| Compound Name | (6-fluoro-2,3-dihydroindol-1-yl)-(1H-indol-4-yl)methanone |
|---|---|
| PubChem CID | 103720917 |
| Molecular Formula | C17H13FN2O |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (6-fluoro-2,3-dihydroindol-1-yl)-(1H-indol-4-yl)methanone |
| SMILES | O=C(c1cccc2[nH]ccc12)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C17H13FN2O/c18-12-5-4-11-7-9-20(16(11)10-12)17(21)14-2-1-3-15-13(14)6-8-19-15/h1-6,8,10,19H,7,9H2 |
| InChIKey | WYYBDLOWIJWUPP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |