C10H11FN2O — CID 103796139
2-amino-1-(6-fluoro-2,3-dihydroindol-1-yl)ethanone (PubChem CID 103796139) has the molecular formula C10H11FN2O and a molecular weight of 194.21 g/mol. Its IUPAC name is 2-amino-1-(6-fluoro-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-amino-1-(6-fluoro-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 103796139 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-amino-1-(6-fluoro-2,3-dihydroindol-1-yl)ethanone |
| SMILES | NCC(=O)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C10H11FN2O/c11-8-2-1-7-3-4-13(9(7)5-8)10(14)6-12/h1-2,5H,3-4,6,12H2 |
| InChIKey | QFWLXVSDNJDQCK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |