C11H11FN2OS — CID 103495606
3-(6-fluoro-2,3-dihydroindol-1-yl)-3-oxopropanethioamide (PubChem CID 103495606) has the molecular formula C11H11FN2OS and a molecular weight of 238.29 g/mol. Its IUPAC name is 3-(6-fluoro-2,3-dihydroindol-1-yl)-3-oxopropanethioamide.
| Compound Name | 3-(6-fluoro-2,3-dihydroindol-1-yl)-3-oxopropanethioamide |
|---|---|
| PubChem CID | 103495606 |
| Molecular Formula | C11H11FN2OS |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 3-(6-fluoro-2,3-dihydroindol-1-yl)-3-oxopropanethioamide |
| SMILES | NC(=S)CC(=O)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C11H11FN2OS/c12-8-2-1-7-3-4-14(9(7)5-8)11(15)6-10(13)16/h1-2,5H,3-4,6H2,(H2,13,16) |
| InChIKey | LZAYGZMADKNOSH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|