C14H17FN2OS — CID 103495616
2-(6-fluoro-2,3-dihydroindole-1-carbonyl)-2-methylbutanethioamide (PubChem CID 103495616) has the molecular formula C14H17FN2OS and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-(6-fluoro-2,3-dihydroindole-1-carbonyl)-2-methylbutanethioamide.
| Compound Name | 2-(6-fluoro-2,3-dihydroindole-1-carbonyl)-2-methylbutanethioamide |
|---|---|
| PubChem CID | 103495616 |
| Molecular Formula | C14H17FN2OS |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-(6-fluoro-2,3-dihydroindole-1-carbonyl)-2-methylbutanethioamide |
| SMILES | CCC(C)(C(=O)N1CCc2ccc(F)cc21)C(N)=S |
| InChI | InChI=1S/C14H17FN2OS/c1-3-14(2,12(16)19)13(18)17-7-6-9-4-5-10(15)8-11(9)17/h4-5,8H,3,6-7H2,1-2H3,(H2,16,19) |
| InChIKey | PJEDMHXLDLWXBR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|